C14H24N6OS — CID 119853614
1-piperidin-4-yl-N-(2-thiomorpholin-4-ylethyl)triazole-4-carboxamide (PubChem CID 119853614) has the molecular formula C14H24N6OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(2-thiomorpholin-4-ylethyl)triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-(2-thiomorpholin-4-ylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119853614 |
| Molecular Formula | C14H24N6OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-piperidin-4-yl-N-(2-thiomorpholin-4-ylethyl)triazole-4-carboxamide |
| SMILES | O=C(NCCN1CCSCC1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C14H24N6OS/c21-14(16-5-6-19-7-9-22-10-8-19)13-11-20(18-17-13)12-1-3-15-4-2-12/h11-12,15H,1-10H2,(H,16,21) |
| InChIKey | NBDJDVWGZFJZFD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |