C13H21N5OS2 — CID 115739489
N-(1,4-dithian-2-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 115739489) has the molecular formula C13H21N5OS2 and a molecular weight of 327.48 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 115739489 |
| Molecular Formula | C13H21N5OS2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NCC1CSCCS1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C13H21N5OS2/c19-13(15-7-11-9-20-5-6-21-11)12-8-18(17-16-12)10-1-3-14-4-2-10/h8,10-11,14H,1-7,9H2,(H,15,19) |
| InChIKey | QULYOPBINVQVJV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |