C15H26ClN5O — CID 119672522
N-(cyclohexylmethyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119672522) has the molecular formula C15H26ClN5O and a molecular weight of 327.86 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(cyclohexylmethyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119672522 |
| Molecular Formula | C15H26ClN5O |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-(cyclohexylmethyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCCC1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C15H25N5O.ClH/c21-15(17-10-12-4-2-1-3-5-12)14-11-20(19-18-14)13-6-8-16-9-7-13;/h11-13,16H,1-10H2,(H,17,21);1H |
| InChIKey | FUSOMTWOILIFAM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |