C17H30N6O — CID 122080776
N-[2-(cycloheptylamino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 122080776) has the molecular formula C17H30N6O and a molecular weight of 334.47 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 122080776 |
| Molecular Formula | C17H30N6O |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NCCNC1CCCCCC1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C17H30N6O/c24-17(20-12-11-19-14-5-3-1-2-4-6-14)16-13-23(22-21-16)15-7-9-18-10-8-15/h13-15,18-19H,1-12H2,(H,20,24) |
| InChIKey | WFQMWMAVQXTKCO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|