C11H17N5O3 — CID 63283122
methyl 2-[(1-piperidin-4-yltriazole-4-carbonyl)amino]acetate (PubChem CID 63283122) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is methyl 2-[(1-piperidin-4-yltriazole-4-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(1-piperidin-4-yltriazole-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 63283122 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | methyl 2-[(1-piperidin-4-yltriazole-4-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C11H17N5O3/c1-19-10(17)6-13-11(18)9-7-16(15-14-9)8-2-4-12-5-3-8/h7-8,12H,2-6H2,1H3,(H,13,18) |
| InChIKey | COLVUGYXWGSHCE-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |