C14H23N5O3 — CID 119726260
ethyl 4-[(1-piperidin-4-yltriazole-4-carbonyl)amino]butanoate (PubChem CID 119726260) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl 4-[(1-piperidin-4-yltriazole-4-carbonyl)amino]butanoate.
| Compound Name | ethyl 4-[(1-piperidin-4-yltriazole-4-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 119726260 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | ethyl 4-[(1-piperidin-4-yltriazole-4-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C14H23N5O3/c1-2-22-13(20)4-3-7-16-14(21)12-10-19(18-17-12)11-5-8-15-9-6-11/h10-11,15H,2-9H2,1H3,(H,16,21) |
| InChIKey | SQFPVEKYNQTUCI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|