C18H24ClN5O3 — CID 119746496
ethyl 4-[[(1-piperidin-4-yltriazole-4-carbonyl)amino]methyl]benzoate;hydrochloride (PubChem CID 119746496) has the molecular formula C18H24ClN5O3 and a molecular weight of 393.88 g/mol. Its IUPAC name is ethyl 4-[[(1-piperidin-4-yltriazole-4-carbonyl)amino]methyl]benzoate;hydrochloride.
| Compound Name | ethyl 4-[[(1-piperidin-4-yltriazole-4-carbonyl)amino]methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119746496 |
| Molecular Formula | C18H24ClN5O3 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl 4-[[(1-piperidin-4-yltriazole-4-carbonyl)amino]methyl]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(CNC(=O)c2cn(C3CCNCC3)nn2)cc1.Cl |
| InChI | InChI=1S/C18H23N5O3.ClH/c1-2-26-18(25)14-5-3-13(4-6-14)11-20-17(24)16-12-23(22-21-16)15-7-9-19-10-8-15;/h3-6,12,15,19H,2,7-11H2,1H3,(H,20,24);1H |
| InChIKey | MOKXZZBVCAXKNG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |