C19H26ClN5O3 — CID 119805449
ethyl 2-phenyl-3-[(1-piperidin-4-yltriazole-4-carbonyl)amino]propanoate;hydrochloride (PubChem CID 119805449) has the molecular formula C19H26ClN5O3 and a molecular weight of 407.90 g/mol. Its IUPAC name is ethyl 2-phenyl-3-[(1-piperidin-4-yltriazole-4-carbonyl)amino]propanoate;hydrochloride.
| Compound Name | ethyl 2-phenyl-3-[(1-piperidin-4-yltriazole-4-carbonyl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119805449 |
| Molecular Formula | C19H26ClN5O3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | ethyl 2-phenyl-3-[(1-piperidin-4-yltriazole-4-carbonyl)amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)C(CNC(=O)c1cn(C2CCNCC2)nn1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H25N5O3.ClH/c1-2-27-19(26)16(14-6-4-3-5-7-14)12-21-18(25)17-13-24(23-22-17)15-8-10-20-11-9-15;/h3-7,13,15-16,20H,2,8-12H2,1H3,(H,21,25);1H |
| InChIKey | JJGAJJWDEXEMAD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |