C17H24ClN5OS — CID 119804407
N-(2-phenylsulfanylpropyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119804407) has the molecular formula C17H24ClN5OS and a molecular weight of 381.93 g/mol. Its IUPAC name is N-(2-phenylsulfanylpropyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(2-phenylsulfanylpropyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119804407 |
| Molecular Formula | C17H24ClN5OS |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-(2-phenylsulfanylpropyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CC(CNC(=O)c1cn(C2CCNCC2)nn1)Sc1ccccc1.Cl |
| InChI | InChI=1S/C17H23N5OS.ClH/c1-13(24-15-5-3-2-4-6-15)11-19-17(23)16-12-22(21-20-16)14-7-9-18-10-8-14;/h2-6,12-14,18H,7-11H2,1H3,(H,19,23);1H |
| InChIKey | JLYCBAHZXWREGJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |