C17H22ClN5O3 — CID 119672434
ethyl 4-[(1-piperidin-4-yltriazole-4-carbonyl)amino]benzoate;hydrochloride (PubChem CID 119672434) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is ethyl 4-[(1-piperidin-4-yltriazole-4-carbonyl)amino]benzoate;hydrochloride.
| Compound Name | ethyl 4-[(1-piperidin-4-yltriazole-4-carbonyl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119672434 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | ethyl 4-[(1-piperidin-4-yltriazole-4-carbonyl)amino]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cn(C3CCNCC3)nn2)cc1.Cl |
| InChI | InChI=1S/C17H21N5O3.ClH/c1-2-25-17(24)12-3-5-13(6-4-12)19-16(23)15-11-22(21-20-15)14-7-9-18-10-8-14;/h3-6,11,14,18H,2,7-10H2,1H3,(H,19,23);1H |
| InChIKey | BXUUOJOTPOZYSI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |