C20H24Cl2N6O — CID 119828958
1-piperidin-4-yl-N-[4-(pyridin-4-ylmethyl)phenyl]triazole-4-carboxamide;dihydrochloride (PubChem CID 119828958) has the molecular formula C20H24Cl2N6O and a molecular weight of 435.36 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[4-(pyridin-4-ylmethyl)phenyl]triazole-4-carboxamide;dihydrochloride.
| Compound Name | 1-piperidin-4-yl-N-[4-(pyridin-4-ylmethyl)phenyl]triazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119828958 |
| Molecular Formula | C20H24Cl2N6O |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-piperidin-4-yl-N-[4-(pyridin-4-ylmethyl)phenyl]triazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(Cc2ccncc2)cc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C20H22N6O.2ClH/c27-20(19-14-26(25-24-19)18-7-11-22-12-8-18)23-17-3-1-15(2-4-17)13-16-5-9-21-10-6-16;;/h1-6,9-10,14,18,22H,7-8,11-13H2,(H,23,27);2*1H |
| InChIKey | HQGOPOWPXBAWHS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |