C20H28N6O — CID 119862108
1-piperidin-4-yl-N-[4-(2-pyrrolidin-1-ylethyl)phenyl]triazole-4-carboxamide (PubChem CID 119862108) has the molecular formula C20H28N6O and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[4-(2-pyrrolidin-1-ylethyl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-[4-(2-pyrrolidin-1-ylethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119862108 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 1-piperidin-4-yl-N-[4-(2-pyrrolidin-1-ylethyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(CCN2CCCC2)cc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C20H28N6O/c27-20(19-15-26(24-23-19)18-7-10-21-11-8-18)22-17-5-3-16(4-6-17)9-14-25-12-1-2-13-25/h3-6,15,18,21H,1-2,7-14H2,(H,22,27) |
| InChIKey | YRZMAOOSKVZRPT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |