C17H25Cl2N7O — CID 119839749
1-piperidin-4-yl-N-(6-pyrrolidin-1-yl-3-pyridinyl)triazole-4-carboxamide;dihydrochloride (PubChem CID 119839749) has the molecular formula C17H25Cl2N7O and a molecular weight of 414.34 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(6-pyrrolidin-1-yl-3-pyridinyl)triazole-4-carboxamide;dihydrochloride.
| Compound Name | 1-piperidin-4-yl-N-(6-pyrrolidin-1-yl-3-pyridinyl)triazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119839749 |
| Molecular Formula | C17H25Cl2N7O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-piperidin-4-yl-N-(6-pyrrolidin-1-yl-3-pyridinyl)triazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(N2CCCC2)nc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C17H23N7O.2ClH/c25-17(15-12-24(22-21-15)14-5-7-18-8-6-14)20-13-3-4-16(19-11-13)23-9-1-2-10-23;;/h3-4,11-12,14,18H,1-2,5-10H2,(H,20,25);2*1H |
| InChIKey | CZZOTQPRHMQRHG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |