C16H21N5O3 — CID 119673884
N-(3,5-dimethoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119673884) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119673884 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | COc1cc(NC(=O)c2cn(C3CCNCC3)nn2)cc(OC)c1 |
| InChI | InChI=1S/C16H21N5O3/c1-23-13-7-11(8-14(9-13)24-2)18-16(22)15-10-21(20-19-15)12-3-5-17-6-4-12/h7-10,12,17H,3-6H2,1-2H3,(H,18,22) |
| InChIKey | GSFFUPUDCWTAHS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |