C16H20ClN5O3 — CID 119679642
methyl 3-[(1-piperidin-4-yltriazole-4-carbonyl)amino]benzoate;hydrochloride (PubChem CID 119679642) has the molecular formula C16H20ClN5O3 and a molecular weight of 365.82 g/mol. Its IUPAC name is methyl 3-[(1-piperidin-4-yltriazole-4-carbonyl)amino]benzoate;hydrochloride.
| Compound Name | methyl 3-[(1-piperidin-4-yltriazole-4-carbonyl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119679642 |
| Molecular Formula | C16H20ClN5O3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl 3-[(1-piperidin-4-yltriazole-4-carbonyl)amino]benzoate;hydrochloride |
| SMILES | COC(=O)c1cccc(NC(=O)c2cn(C3CCNCC3)nn2)c1.Cl |
| InChI | InChI=1S/C16H19N5O3.ClH/c1-24-16(23)11-3-2-4-12(9-11)18-15(22)14-10-21(20-19-14)13-5-7-17-8-6-13;/h2-4,9-10,13,17H,5-8H2,1H3,(H,18,22);1H |
| InChIKey | ZNLSXJQGHNBNTI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |