C19H27ClN6O2 — CID 119685390
N-[3-(diethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119685390) has the molecular formula C19H27ClN6O2 and a molecular weight of 406.92 g/mol. Its IUPAC name is N-[3-(diethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[3-(diethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119685390 |
| Molecular Formula | C19H27ClN6O2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[3-(diethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2cn(C3CCNCC3)nn2)c1.Cl |
| InChI | InChI=1S/C19H26N6O2.ClH/c1-3-24(4-2)19(27)14-6-5-7-15(12-14)21-18(26)17-13-25(23-22-17)16-8-10-20-11-9-16;/h5-7,12-13,16,20H,3-4,8-11H2,1-2H3,(H,21,26);1H |
| InChIKey | FNYCSDAPRCLGKK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |