C17H21ClN6O2 — CID 119718961
N-[4-chloro-3-(dimethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119718961) has the molecular formula C17H21ClN6O2 and a molecular weight of 376.85 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[4-chloro-3-(dimethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119718961 |
| Molecular Formula | C17H21ClN6O2 |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[4-chloro-3-(dimethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1cc(NC(=O)c2cn(C3CCNCC3)nn2)ccc1Cl |
| InChI | InChI=1S/C17H21ClN6O2/c1-23(2)17(26)13-9-11(3-4-14(13)18)20-16(25)15-10-24(22-21-15)12-5-7-19-8-6-12/h3-4,9-10,12,19H,5-8H2,1-2H3,(H,20,25) |
| InChIKey | YIQRBXPAUUAMNV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |