C20H22ClN5O2 — CID 119673234
N-(3-phenoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119673234) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is N-(3-phenoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(3-phenoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119673234 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-(3-phenoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(Oc2ccccc2)c1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C20H21N5O2.ClH/c26-20(19-14-25(24-23-19)16-9-11-21-12-10-16)22-15-5-4-8-18(13-15)27-17-6-2-1-3-7-17;/h1-8,13-14,16,21H,9-12H2,(H,22,26);1H |
| InChIKey | KAAFTRHUZOARKX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |