C18H20ClN5OS — CID 119708561
1-piperidin-4-yl-N-(3-thiophen-2-ylphenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119708561) has the molecular formula C18H20ClN5OS and a molecular weight of 389.91 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(3-thiophen-2-ylphenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-piperidin-4-yl-N-(3-thiophen-2-ylphenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119708561 |
| Molecular Formula | C18H20ClN5OS |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 1-piperidin-4-yl-N-(3-thiophen-2-ylphenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(-c2cccs2)c1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C18H19N5OS.ClH/c24-18(16-12-23(22-21-16)15-6-8-19-9-7-15)20-14-4-1-3-13(11-14)17-5-2-10-25-17;/h1-5,10-12,15,19H,6-9H2,(H,20,24);1H |
| InChIKey | RAVZJQNNDLGNFP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |