C17H17ClN6OS — CID 166252442
N-[3-(5-chlorothiadiazol-4-yl)phenyl]-1-cyclohexyltriazole-4-carboxamide (PubChem CID 166252442) has the molecular formula C17H17ClN6OS and a molecular weight of 388.88 g/mol. Its IUPAC name is N-[3-(5-chlorothiadiazol-4-yl)phenyl]-1-cyclohexyltriazole-4-carboxamide.
| Compound Name | N-[3-(5-chlorothiadiazol-4-yl)phenyl]-1-cyclohexyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 166252442 |
| Molecular Formula | C17H17ClN6OS |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[3-(5-chlorothiadiazol-4-yl)phenyl]-1-cyclohexyltriazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nnsc2Cl)c1)c1cn(C2CCCCC2)nn1 |
| InChI | InChI=1S/C17H17ClN6OS/c18-16-15(21-23-26-16)11-5-4-6-12(9-11)19-17(25)14-10-24(22-20-14)13-7-2-1-3-8-13/h4-6,9-10,13H,1-3,7-8H2,(H,19,25) |
| InChIKey | LPNDCHILFWIVDZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |