C22H26ClN5O2 — CID 119766161
N-[1-(4-phenoxyphenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119766161) has the molecular formula C22H26ClN5O2 and a molecular weight of 427.94 g/mol. Its IUPAC name is N-[1-(4-phenoxyphenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[1-(4-phenoxyphenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119766161 |
| Molecular Formula | C22H26ClN5O2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-[1-(4-phenoxyphenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CC(NC(=O)c1cn(C2CCNCC2)nn1)c1ccc(Oc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C22H25N5O2.ClH/c1-16(17-7-9-20(10-8-17)29-19-5-3-2-4-6-19)24-22(28)21-15-27(26-25-21)18-11-13-23-14-12-18;/h2-10,15-16,18,23H,11-14H2,1H3,(H,24,28);1H |
| InChIKey | UIDIGBAGSLIACQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |