C16H19Cl2N5O — CID 119685991
N-[1-(3,4-dichlorophenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119685991) has the molecular formula C16H19Cl2N5O and a molecular weight of 368.27 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119685991 |
| Molecular Formula | C16H19Cl2N5O |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cn(C2CCNCC2)nn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2N5O/c1-10(11-2-3-13(17)14(18)8-11)20-16(24)15-9-23(22-21-15)12-4-6-19-7-5-12/h2-3,8-10,12,19H,4-7H2,1H3,(H,20,24) |
| InChIKey | KKGJDWYTHXXJLN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |