C18H26ClN5O2 — CID 119745541
N-[1-(3-ethoxyphenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119745541) has the molecular formula C18H26ClN5O2 and a molecular weight of 379.89 g/mol. Its IUPAC name is N-[1-(3-ethoxyphenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[1-(3-ethoxyphenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119745541 |
| Molecular Formula | C18H26ClN5O2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-[1-(3-ethoxyphenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCOc1cccc(C(C)NC(=O)c2cn(C3CCNCC3)nn2)c1.Cl |
| InChI | InChI=1S/C18H25N5O2.ClH/c1-3-25-16-6-4-5-14(11-16)13(2)20-18(24)17-12-23(22-21-17)15-7-9-19-10-8-15;/h4-6,11-13,15,19H,3,7-10H2,1-2H3,(H,20,24);1H |
| InChIKey | SWXUHEDJMFNORP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |