C17H24ClN5O2 — CID 119714461
N-[(3-ethoxyphenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119714461) has the molecular formula C17H24ClN5O2 and a molecular weight of 365.87 g/mol. Its IUPAC name is N-[(3-ethoxyphenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[(3-ethoxyphenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119714461 |
| Molecular Formula | C17H24ClN5O2 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[(3-ethoxyphenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCOc1cccc(CNC(=O)c2cn(C3CCNCC3)nn2)c1.Cl |
| InChI | InChI=1S/C17H23N5O2.ClH/c1-2-24-15-5-3-4-13(10-15)11-19-17(23)16-12-22(21-20-16)14-6-8-18-9-7-14;/h3-5,10,12,14,18H,2,6-9,11H2,1H3,(H,19,23);1H |
| InChIKey | WZHLTKKERIBEGX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |