C18H23F2N5O3 — CID 119816488
N-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119816488) has the molecular formula C18H23F2N5O3 and a molecular weight of 395.41 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119816488 |
| Molecular Formula | C18H23F2N5O3 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CCOc1cccc(CNC(=O)c2cn(C3CCNCC3)nn2)c1OC(F)F |
| InChI | InChI=1S/C18H23F2N5O3/c1-2-27-15-5-3-4-12(16(15)28-18(19)20)10-22-17(26)14-11-25(24-23-14)13-6-8-21-9-7-13/h3-5,11,13,18,21H,2,6-10H2,1H3,(H,22,26) |
| InChIKey | UAPURIDRTRWJIC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |