C19H27N5O2 — CID 119734208
1-piperidin-4-yl-N-[[2-(propoxymethyl)phenyl]methyl]triazole-4-carboxamide (PubChem CID 119734208) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[[2-(propoxymethyl)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-[[2-(propoxymethyl)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119734208 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-piperidin-4-yl-N-[[2-(propoxymethyl)phenyl]methyl]triazole-4-carboxamide |
| SMILES | CCCOCc1ccccc1CNC(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C19H27N5O2/c1-2-11-26-14-16-6-4-3-5-15(16)12-21-19(25)18-13-24(23-22-18)17-7-9-20-10-8-17/h3-6,13,17,20H,2,7-12,14H2,1H3,(H,21,25) |
| InChIKey | GBWLNKHFMFYGGJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|