C16H19F2N5O2 — CID 119700358
N-[[2-(difluoromethoxy)phenyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119700358) has the molecular formula C16H19F2N5O2 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119700358 |
| Molecular Formula | C16H19F2N5O2 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C16H19F2N5O2/c17-16(18)25-14-4-2-1-3-11(14)9-20-15(24)13-10-23(22-21-13)12-5-7-19-8-6-12/h1-4,10,12,16,19H,5-9H2,(H,20,24) |
| InChIKey | HVNJBVHGKCOTHT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |