C17H23N5O3 — CID 119705244
N-[(2,4-dimethoxyphenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119705244) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119705244 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cn(C3CCNCC3)nn2)c(OC)c1 |
| InChI | InChI=1S/C17H23N5O3/c1-24-14-4-3-12(16(9-14)25-2)10-19-17(23)15-11-22(21-20-15)13-5-7-18-8-6-13/h3-4,9,11,13,18H,5-8,10H2,1-2H3,(H,19,23) |
| InChIKey | OLWADKHZVGCBHM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |