C18H26ClN5O4 — CID 119822603
N-[2-(3,5-dimethoxyphenoxy)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119822603) has the molecular formula C18H26ClN5O4 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenoxy)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119822603 |
| Molecular Formula | C18H26ClN5O4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | COc1cc(OC)cc(OCCNC(=O)c2cn(C3CCNCC3)nn2)c1.Cl |
| InChI | InChI=1S/C18H25N5O4.ClH/c1-25-14-9-15(26-2)11-16(10-14)27-8-7-20-18(24)17-12-23(22-21-17)13-3-5-19-6-4-13;/h9-13,19H,3-8H2,1-2H3,(H,20,24);1H |
| InChIKey | VIANUHYWFLWRFL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|