C15H19ClN6O2 — CID 119900756
N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119900756) has the molecular formula C15H19ClN6O2 and a molecular weight of 350.81 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119900756 |
| Molecular Formula | C15H19ClN6O2 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(Cl)cn1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C15H19ClN6O2/c16-11-1-2-14(19-9-11)24-8-7-18-15(23)13-10-22(21-20-13)12-3-5-17-6-4-12/h1-2,9-10,12,17H,3-8H2,(H,18,23) |
| InChIKey | IXEQZDXHHANVMI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|