C16H20ClN5O — CID 119688217
N-[2-(3-chlorophenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119688217) has the molecular formula C16H20ClN5O and a molecular weight of 333.82 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119688217 |
| Molecular Formula | C16H20ClN5O |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C16H20ClN5O/c17-13-3-1-2-12(10-13)4-9-19-16(23)15-11-22(21-20-15)14-5-7-18-8-6-14/h1-3,10-11,14,18H,4-9H2,(H,19,23) |
| InChIKey | KCSFZHMCBNGEDT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |