C14H16FN5O — CID 79320078
1-(azetidin-3-yl)-N-[2-(3-fluorophenyl)ethyl]triazole-4-carboxamide (PubChem CID 79320078) has the molecular formula C14H16FN5O and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N-[2-(3-fluorophenyl)ethyl]triazole-4-carboxamide.
| Compound Name | 1-(azetidin-3-yl)-N-[2-(3-fluorophenyl)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 79320078 |
| Molecular Formula | C14H16FN5O |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(azetidin-3-yl)-N-[2-(3-fluorophenyl)ethyl]triazole-4-carboxamide |
| SMILES | O=C(NCCc1cccc(F)c1)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C14H16FN5O/c15-11-3-1-2-10(6-11)4-5-17-14(21)13-9-20(19-18-13)12-7-16-8-12/h1-3,6,9,12,16H,4-5,7-8H2,(H,17,21) |
| InChIKey | ITQIBKYEVYNRKS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |