C13H12F2N4O — CID 116590710
1-[1-(azetidin-3-yl)triazol-4-yl]-2-(2,4-difluorophenyl)ethanone (PubChem CID 116590710) has the molecular formula C13H12F2N4O and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-[1-(azetidin-3-yl)triazol-4-yl]-2-(2,4-difluorophenyl)ethanone.
| Compound Name | 1-[1-(azetidin-3-yl)triazol-4-yl]-2-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 116590710 |
| Molecular Formula | C13H12F2N4O |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1-[1-(azetidin-3-yl)triazol-4-yl]-2-(2,4-difluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1F)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C13H12F2N4O/c14-9-2-1-8(11(15)4-9)3-13(20)12-7-19(18-17-12)10-5-16-6-10/h1-2,4,7,10,16H,3,5-6H2 |
| InChIKey | TYNDLIAJVLBDIL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |