C12H14N6O — CID 116590781
2-(2-amino-3-pyridinyl)-1-[1-(azetidin-3-yl)triazol-4-yl]ethanone (PubChem CID 116590781) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-(2-amino-3-pyridinyl)-1-[1-(azetidin-3-yl)triazol-4-yl]ethanone.
| Compound Name | 2-(2-amino-3-pyridinyl)-1-[1-(azetidin-3-yl)triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 116590781 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(2-amino-3-pyridinyl)-1-[1-(azetidin-3-yl)triazol-4-yl]ethanone |
| SMILES | Nc1ncccc1CC(=O)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C12H14N6O/c13-12-8(2-1-3-15-12)4-11(19)10-7-18(17-16-10)9-5-14-6-9/h1-3,7,9,14H,4-6H2,(H2,13,15) |
| InChIKey | RRMBFFBRXGCEFZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |