C9H13N5O3 — CID 79317214
methyl 2-[[1-(azetidin-3-yl)triazole-4-carbonyl]amino]acetate (PubChem CID 79317214) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is methyl 2-[[1-(azetidin-3-yl)triazole-4-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[1-(azetidin-3-yl)triazole-4-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 79317214 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | methyl 2-[[1-(azetidin-3-yl)triazole-4-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C9H13N5O3/c1-17-8(15)4-11-9(16)7-5-14(13-12-7)6-2-10-3-6/h5-6,10H,2-4H2,1H3,(H,11,16) |
| InChIKey | HWWXGQGFARWANF-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |