C11H17N5O3 — CID 79316716
3-[[1-(azetidin-3-yl)triazole-4-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 79316716) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-[[1-(azetidin-3-yl)triazole-4-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 3-[[1-(azetidin-3-yl)triazole-4-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79316716 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-[[1-(azetidin-3-yl)triazole-4-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C11H17N5O3/c1-11(2,3-9(17)18)13-10(19)8-6-16(15-14-8)7-4-12-5-7/h6-7,12H,3-5H2,1-2H3,(H,13,19)(H,17,18) |
| InChIKey | PFNJYGZLAZVSOS-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |