C13H20N6O2 — CID 79318572
N-(1-acetylpiperidin-4-yl)-1-(azetidin-3-yl)triazole-4-carboxamide (PubChem CID 79318572) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-1-(azetidin-3-yl)triazole-4-carboxamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-1-(azetidin-3-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 79318572 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-1-(azetidin-3-yl)triazole-4-carboxamide |
| SMILES | CC(=O)N1CCC(NC(=O)c2cn(C3CNC3)nn2)CC1 |
| InChI | InChI=1S/C13H20N6O2/c1-9(20)18-4-2-10(3-5-18)15-13(21)12-8-19(17-16-12)11-6-14-7-11/h8,10-11,14H,2-7H2,1H3,(H,15,21) |
| InChIKey | SJDCCGZATIJWIZ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |