C11H16N6O2 — CID 79317007
1-(azetidin-3-yl)-N-(2-oxopiperidin-3-yl)triazole-4-carboxamide (PubChem CID 79317007) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N-(2-oxopiperidin-3-yl)triazole-4-carboxamide.
| Compound Name | 1-(azetidin-3-yl)-N-(2-oxopiperidin-3-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 79317007 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-(azetidin-3-yl)-N-(2-oxopiperidin-3-yl)triazole-4-carboxamide |
| SMILES | O=C(NC1CCCNC1=O)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C11H16N6O2/c18-10-8(2-1-3-13-10)14-11(19)9-6-17(16-15-9)7-4-12-5-7/h6-8,12H,1-5H2,(H,13,18)(H,14,19) |
| InChIKey | RFOBKKYCDUNXAM-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |