C10H13N5O2 — CID 55041508
6-amino-N-(2-oxopiperidin-3-yl)pyridazine-3-carboxamide (PubChem CID 55041508) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 6-amino-N-(2-oxopiperidin-3-yl)pyridazine-3-carboxamide.
| Compound Name | 6-amino-N-(2-oxopiperidin-3-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55041508 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 6-amino-N-(2-oxopiperidin-3-yl)pyridazine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)NC2CCCNC2=O)nn1 |
| InChI | InChI=1S/C10H13N5O2/c11-8-4-3-7(14-15-8)10(17)13-6-2-1-5-12-9(6)16/h3-4,6H,1-2,5H2,(H2,11,15)(H,12,16)(H,13,17) |
| InChIKey | AMYZZLQYIRNFKX-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |