C11H15N5O2 — CID 104642267
5-hydrazinyl-N-(2-oxopiperidin-3-yl)pyridine-2-carboxamide (PubChem CID 104642267) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-hydrazinyl-N-(2-oxopiperidin-3-yl)pyridine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-(2-oxopiperidin-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104642267 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 5-hydrazinyl-N-(2-oxopiperidin-3-yl)pyridine-2-carboxamide |
| SMILES | NNc1ccc(C(=O)NC2CCCNC2=O)nc1 |
| InChI | InChI=1S/C11H15N5O2/c12-16-7-3-4-8(14-6-7)11(18)15-9-2-1-5-13-10(9)17/h3-4,6,9,16H,1-2,5,12H2,(H,13,17)(H,15,18) |
| InChIKey | DKUIVVLZMBZBPN-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|