C11H14N4O2 — CID 113447702
3-amino-N-(2-oxopiperidin-3-yl)pyridine-2-carboxamide (PubChem CID 113447702) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3-amino-N-(2-oxopiperidin-3-yl)pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(2-oxopiperidin-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113447702 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-amino-N-(2-oxopiperidin-3-yl)pyridine-2-carboxamide |
| SMILES | Nc1cccnc1C(=O)NC1CCCNC1=O |
| InChI | InChI=1S/C11H14N4O2/c12-7-3-1-5-13-9(7)11(17)15-8-4-2-6-14-10(8)16/h1,3,5,8H,2,4,6,12H2,(H,14,16)(H,15,17) |
| InChIKey | DERCQPJYLDVYBC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |