C12H14N2O4 — CID 114344266
2,3-dihydroxy-N-(2-oxopiperidin-3-yl)benzamide (PubChem CID 114344266) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(2-oxopiperidin-3-yl)benzamide.
| Compound Name | 2,3-dihydroxy-N-(2-oxopiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 114344266 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2,3-dihydroxy-N-(2-oxopiperidin-3-yl)benzamide |
| SMILES | O=C(NC1CCCNC1=O)c1cccc(O)c1O |
| InChI | InChI=1S/C12H14N2O4/c15-9-5-1-3-7(10(9)16)11(17)14-8-4-2-6-13-12(8)18/h1,3,5,8,15-16H,2,4,6H2,(H,13,18)(H,14,17) |
| InChIKey | RENDLVDWBRXCAM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|