C14H18FN3O2 — CID 62662588
2-(ethylamino)-3-fluoro-N-(2-oxopiperidin-3-yl)benzamide (PubChem CID 62662588) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-(ethylamino)-3-fluoro-N-(2-oxopiperidin-3-yl)benzamide.
| Compound Name | 2-(ethylamino)-3-fluoro-N-(2-oxopiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 62662588 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-(ethylamino)-3-fluoro-N-(2-oxopiperidin-3-yl)benzamide |
| SMILES | CCNc1c(F)cccc1C(=O)NC1CCCNC1=O |
| InChI | InChI=1S/C14H18FN3O2/c1-2-16-12-9(5-3-6-10(12)15)13(19)18-11-7-4-8-17-14(11)20/h3,5-6,11,16H,2,4,7-8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | VUDHHEBOAXWSAG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |