C11H15FN2O — CID 62648907
N-ethyl-2-(ethylamino)-3-fluorobenzamide (PubChem CID 62648907) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is N-ethyl-2-(ethylamino)-3-fluorobenzamide.
| Compound Name | N-ethyl-2-(ethylamino)-3-fluorobenzamide |
|---|---|
| PubChem CID | 62648907 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-ethyl-2-(ethylamino)-3-fluorobenzamide |
| SMILES | CCNC(=O)c1cccc(F)c1NCC |
| InChI | InChI=1S/C11H15FN2O/c1-3-13-10-8(11(15)14-4-2)6-5-7-9(10)12/h5-7,13H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | MVLHLPKOYGUDHG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |