C13H18FN3O2 — CID 62660729
N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-(ethylamino)-3-fluorobenzamide (PubChem CID 62660729) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-(ethylamino)-3-fluorobenzamide.
| Compound Name | N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-(ethylamino)-3-fluorobenzamide |
|---|---|
| PubChem CID | 62660729 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-(ethylamino)-3-fluorobenzamide |
| SMILES | CCNc1c(F)cccc1C(=O)NC(C)(C)C(N)=O |
| InChI | InChI=1S/C13H18FN3O2/c1-4-16-10-8(6-5-7-9(10)14)11(18)17-13(2,3)12(15)19/h5-7,16H,4H2,1-3H3,(H2,15,19)(H,17,18) |
| InChIKey | NKWMDFFJRSZRLH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |