C11H12F4N2O — CID 55100188
2-(ethylamino)-3-fluoro-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 55100188) has the molecular formula C11H12F4N2O and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-(ethylamino)-3-fluoro-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-(ethylamino)-3-fluoro-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 55100188 |
| Molecular Formula | C11H12F4N2O |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(ethylamino)-3-fluoro-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCNc1c(F)cccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H12F4N2O/c1-2-16-9-7(4-3-5-8(9)12)10(18)17-6-11(13,14)15/h3-5,16H,2,6H2,1H3,(H,17,18) |
| InChIKey | LUEVJUMFIPPIGS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |