C12H15N5OS — CID 79316779
1-(azetidin-3-yl)-N-(2-thiophen-3-ylethyl)triazole-4-carboxamide (PubChem CID 79316779) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N-(2-thiophen-3-ylethyl)triazole-4-carboxamide.
| Compound Name | 1-(azetidin-3-yl)-N-(2-thiophen-3-ylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 79316779 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-(azetidin-3-yl)-N-(2-thiophen-3-ylethyl)triazole-4-carboxamide |
| SMILES | O=C(NCCc1ccsc1)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C12H15N5OS/c18-12(14-3-1-9-2-4-19-8-9)11-7-17(16-15-11)10-5-13-6-10/h2,4,7-8,10,13H,1,3,5-6H2,(H,14,18) |
| InChIKey | KGOOSCPCSKAYBT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |