C14H19N5OS — CID 63283028
1-piperidin-4-yl-N-(2-thiophen-2-ylethyl)triazole-4-carboxamide (PubChem CID 63283028) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(2-thiophen-2-ylethyl)triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-(2-thiophen-2-ylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 63283028 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-piperidin-4-yl-N-(2-thiophen-2-ylethyl)triazole-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C14H19N5OS/c20-14(16-8-5-12-2-1-9-21-12)13-10-19(18-17-13)11-3-6-15-7-4-11/h1-2,9-11,15H,3-8H2,(H,16,20) |
| InChIKey | JVDVMDYAHUYSEP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |