C16H21N5OS — CID 119689941
1-piperidin-4-yl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)triazole-4-carboxamide (PubChem CID 119689941) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119689941 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-piperidin-4-yl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C16H21N5OS/c1-2-9-20(11-14-4-3-10-23-14)16(22)15-12-21(19-18-15)13-5-7-17-8-6-13/h2-4,10,12-13,17H,1,5-9,11H2 |
| InChIKey | RDFQOWQAGCZJEH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|