C15H22N4O — CID 42194943
1-cyclohexyl-N,N-bis(prop-2-enyl)triazole-4-carboxamide (PubChem CID 42194943) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-cyclohexyl-N,N-bis(prop-2-enyl)triazole-4-carboxamide.
| Compound Name | 1-cyclohexyl-N,N-bis(prop-2-enyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 42194943 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-cyclohexyl-N,N-bis(prop-2-enyl)triazole-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cn(C2CCCCC2)nn1 |
| InChI | InChI=1S/C15H22N4O/c1-3-10-18(11-4-2)15(20)14-12-19(17-16-14)13-8-6-5-7-9-13/h3-4,12-13H,1-2,5-11H2 |
| InChIKey | LJMLYRGIQDJHHC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|